C18H16Cl3NO — CID 19857946
3-(1-chlorobutyl)-4-[(2,4-dichlorophenyl)methoxy]benzonitrile (PubChem CID 19857946) has the molecular formula C18H16Cl3NO and a molecular weight of 368.69 g/mol. Its IUPAC name is 3-(1-chlorobutyl)-4-[(2,4-dichlorophenyl)methoxy]benzonitrile.
| Compound Name | 3-(1-chlorobutyl)-4-[(2,4-dichlorophenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 19857946 |
| Molecular Formula | C18H16Cl3NO |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-(1-chlorobutyl)-4-[(2,4-dichlorophenyl)methoxy]benzonitrile |
| SMILES | CCCC(Cl)c1cc(C#N)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3NO/c1-2-3-16(20)15-8-12(10-22)4-7-18(15)23-11-13-5-6-14(19)9-17(13)21/h4-9,16H,2-3,11H2,1H3 |
| InChIKey | NCXRXJPCBFWPOV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|