C7H16N2O — CID 19874145
N,N-dimethyl-1-(1,3-oxazinan-5-yl)methanamine (PubChem CID 19874145) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is N,N-dimethyl-1-(1,3-oxazinan-5-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(1,3-oxazinan-5-yl)methanamine |
|---|---|
| PubChem CID | 19874145 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N,N-dimethyl-1-(1,3-oxazinan-5-yl)methanamine |
| SMILES | CN(C)CC1CNCOC1 |
| InChI | InChI=1S/C7H16N2O/c1-9(2)4-7-3-8-6-10-5-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZDPMHWFKRVSTJJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |