C22H27O6P — CID 19875567
2-[4-[[(2-methoxy-2-oxoethyl)-pentylphosphoryl]oxymethyl]phenyl]benzoic acid (PubChem CID 19875567) has the molecular formula C22H27O6P and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-[4-[[(2-methoxy-2-oxoethyl)-pentylphosphoryl]oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[(2-methoxy-2-oxoethyl)-pentylphosphoryl]oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19875567 |
| Molecular Formula | C22H27O6P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[4-[[(2-methoxy-2-oxoethyl)-pentylphosphoryl]oxymethyl]phenyl]benzoic acid |
| SMILES | CCCCCP(=O)(CC(=O)OC)OCc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H27O6P/c1-3-4-7-14-29(26,16-21(23)27-2)28-15-17-10-12-18(13-11-17)19-8-5-6-9-20(19)22(24)25/h5-6,8-13H,3-4,7,14-16H2,1-2H3,(H,24,25) |
| InChIKey | HTUQADLPMWXWDX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|