C12H9ClN2O — CID 19881213
pyrimido[6,1-a]isoquinolin-4-one;hydrochloride (PubChem CID 19881213) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is pyrimido[6,1-a]isoquinolin-4-one;hydrochloride.
| Compound Name | pyrimido[6,1-a]isoquinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 19881213 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | pyrimido[6,1-a]isoquinolin-4-one;hydrochloride |
| SMILES | Cl.O=c1nccc2c3ccccc3ccn12 |
| InChI | InChI=1S/C12H8N2O.ClH/c15-12-13-7-5-11-10-4-2-1-3-9(10)6-8-14(11)12;/h1-8H;1H |
| InChIKey | BPVAGCHHSBMGER-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|