C17H17NSi — CID 102089193
trimethyl(2-pyrrolo[2,1-a]isoquinolin-3-ylethynyl)silane (PubChem CID 102089193) has the molecular formula C17H17NSi and a molecular weight of 263.42 g/mol. Its IUPAC name is trimethyl(2-pyrrolo[2,1-a]isoquinolin-3-ylethynyl)silane.
| Compound Name | trimethyl(2-pyrrolo[2,1-a]isoquinolin-3-ylethynyl)silane |
|---|---|
| PubChem CID | 102089193 |
| Molecular Formula | C17H17NSi |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | trimethyl(2-pyrrolo[2,1-a]isoquinolin-3-ylethynyl)silane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c3ccccc3ccn12 |
| InChI | InChI=1S/C17H17NSi/c1-19(2,3)13-11-15-8-9-17-16-7-5-4-6-14(16)10-12-18(15)17/h4-10,12H,1-3H3 |
| InChIKey | WMRILJOAVZUFKD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|