C9H13FO2 — CID 19881887
methyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate (PubChem CID 19881887) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is methyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate.
| Compound Name | methyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 19881887 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | methyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
| SMILES | COC(=O)/C(F)=C\C1CC1(C)C |
| InChI | InChI=1S/C9H13FO2/c1-9(2)5-6(9)4-7(10)8(11)12-3/h4,6H,5H2,1-3H3/b7-4+ |
| InChIKey | BSTSLQCYWLUMFY-QPJJXVBHSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|