C11H17FO2 — CID 23168303
propyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate (PubChem CID 23168303) has the molecular formula C11H17FO2 and a molecular weight of 200.25 g/mol. Its IUPAC name is propyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate.
| Compound Name | propyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 23168303 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | propyl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
| SMILES | CCCOC(=O)/C(F)=C\C1CC1(C)C |
| InChI | InChI=1S/C11H17FO2/c1-4-5-14-10(13)9(12)6-8-7-11(8,2)3/h6,8H,4-5,7H2,1-3H3/b9-6+ |
| InChIKey | HYXAJFLJTHGROC-RMKNXTFCSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|