C16H20N2O3 — CID 19882081
ethyl 2-(3,3-dimethyl-6-oxo-5-phenyl-2H-pyrazin-1-yl)acetate (PubChem CID 19882081) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 2-(3,3-dimethyl-6-oxo-5-phenyl-2H-pyrazin-1-yl)acetate.
| Compound Name | ethyl 2-(3,3-dimethyl-6-oxo-5-phenyl-2H-pyrazin-1-yl)acetate |
|---|---|
| PubChem CID | 19882081 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 2-(3,3-dimethyl-6-oxo-5-phenyl-2H-pyrazin-1-yl)acetate |
| SMILES | CCOC(=O)CN1CC(C)(C)N=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H20N2O3/c1-4-21-13(19)10-18-11-16(2,3)17-14(15(18)20)12-8-6-5-7-9-12/h5-9H,4,10-11H2,1-3H3 |
| InChIKey | OHJWNKCUTRPTFX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |