C15H17N2O2S+ — CID 15750485
ethyl 2-(3-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl)acetate (PubChem CID 15750485) has the molecular formula C15H17N2O2S+ and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 2-(3-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl)acetate.
| Compound Name | ethyl 2-(3-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl)acetate |
|---|---|
| PubChem CID | 15750485 |
| Molecular Formula | C15H17N2O2S+ |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl 2-(3-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl)acetate |
| SMILES | CCOC(=O)CN1CC[n+]2c(-c3ccccc3)csc21 |
| InChI | InChI=1S/C15H17N2O2S/c1-2-19-14(18)10-16-8-9-17-13(11-20-15(16)17)12-6-4-3-5-7-12/h3-7,11H,2,8-10H2,1H3/q+1 |
| InChIKey | ZFACNYBJEDGRGL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|