C25H27N3O3 — CID 19884656
3-[4-[2-[(1,2-dihydroxy-3-naphthalen-1-ylpropyl)amino]ethyl]phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 19884656) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[4-[2-[(1,2-dihydroxy-3-naphthalen-1-ylpropyl)amino]ethyl]phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-[2-[(1,2-dihydroxy-3-naphthalen-1-ylpropyl)amino]ethyl]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 19884656 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[4-[2-[(1,2-dihydroxy-3-naphthalen-1-ylpropyl)amino]ethyl]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2ccc(CCNC(O)C(O)Cc3cccc4ccccc34)cc2)=NN1 |
| InChI | InChI=1S/C25H27N3O3/c29-23(16-20-6-3-5-18-4-1-2-7-21(18)20)25(31)26-15-14-17-8-10-19(11-9-17)22-12-13-24(30)28-27-22/h1-11,23,25-26,29,31H,12-16H2,(H,28,30) |
| InChIKey | BVGJPCMATDFRPK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|