C17H15N3O — CID 19895584
4-(5-amino-2-pyridinyl)-2,2-dimethylchromene-6-carbonitrile (PubChem CID 19895584) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-(5-amino-2-pyridinyl)-2,2-dimethylchromene-6-carbonitrile.
| Compound Name | 4-(5-amino-2-pyridinyl)-2,2-dimethylchromene-6-carbonitrile |
|---|---|
| PubChem CID | 19895584 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-(5-amino-2-pyridinyl)-2,2-dimethylchromene-6-carbonitrile |
| SMILES | CC1(C)C=C(c2ccc(N)cn2)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C17H15N3O/c1-17(2)8-14(15-5-4-12(19)10-20-15)13-7-11(9-18)3-6-16(13)21-17/h3-8,10H,19H2,1-2H3 |
| InChIKey | IJIOCJHCTYJKHE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |