About 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine
2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine (PubChem CID 88512223) has the molecular formula C15H15N5O
and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine.
Molecular Properties
| Compound Name | 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine |
| PubChem CID | 88512223 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine |
| SMILES | CN(C1=CC(C)(C)Oc2ccc(C#N)cc21)/C(N)=N/C#N |
| InChI | InChI=1S/C15H15N5O/c1-15(2)7-12(20(3)14(18)19-9-17)11-6-10(8-16)4-5-13(11)21-15/h4-7H,1-3H3,(H2,18,19) |
| InChIKey | AORFZRKZULIBEV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine?
The IUPAC name of 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine (CID 88512223) is 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine.
What is the SMILES notation for 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine?
The canonical SMILES for 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine is CN(C1=CC(C)(C)Oc2ccc(C#N)cc21)/C(N)=N/C#N.
What is the InChIKey of 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine?
The InChIKey is AORFZRKZULIBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O/c1-15(2)7-12(20(3)14(18)19-9-17)11-6-10(8-16)4-5-13(11)21-15/h4-7H,1-3H3,(H2,18,19).
What are the key properties of 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine?
2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine has a molecular weight of 281.32 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine is sourced from PubChem (CID 88512223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).