C15H15N5O — CID 88512223
2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine (PubChem CID 88512223) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine.
| Compound Name | 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 88512223 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-cyano-1-(6-cyano-2,2-dimethylchromen-4-yl)-1-methylguanidine |
| SMILES | CN(C1=CC(C)(C)Oc2ccc(C#N)cc21)/C(N)=N/C#N |
| InChI | InChI=1S/C15H15N5O/c1-15(2)7-12(20(3)14(18)19-9-17)11-6-10(8-16)4-5-13(11)21-15/h4-7H,1-3H3,(H2,18,19) |
| InChIKey | AORFZRKZULIBEV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|