C16H18N4O4 — CID 15042183
N'-cyano-N-(2,2-dimethyl-6-nitrochromen-4-yl)-N-(2-hydroxyethyl)ethanimidamide (PubChem CID 15042183) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N'-cyano-N-(2,2-dimethyl-6-nitrochromen-4-yl)-N-(2-hydroxyethyl)ethanimidamide.
| Compound Name | N'-cyano-N-(2,2-dimethyl-6-nitrochromen-4-yl)-N-(2-hydroxyethyl)ethanimidamide |
|---|---|
| PubChem CID | 15042183 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N'-cyano-N-(2,2-dimethyl-6-nitrochromen-4-yl)-N-(2-hydroxyethyl)ethanimidamide |
| SMILES | C/C(=N\C#N)N(CCO)C1=CC(C)(C)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H18N4O4/c1-11(18-10-17)19(6-7-21)14-9-16(2,3)24-15-5-4-12(20(22)23)8-13(14)15/h4-5,8-9,21H,6-7H2,1-3H3/b18-11+ |
| InChIKey | BLQNHVWTTXZSAS-WOJGMQOQSA-N |
| XLogP | 2.30 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|