C18H16BrN3O5 — CID 22122949
N-[5-bromo-1-(2,2-dimethyl-6-nitrochromen-4-yl)-6-oxo-3-pyridinyl]acetamide (PubChem CID 22122949) has the molecular formula C18H16BrN3O5 and a molecular weight of 434.25 g/mol. Its IUPAC name is N-[5-bromo-1-(2,2-dimethyl-6-nitrochromen-4-yl)-6-oxo-3-pyridinyl]acetamide.
| Compound Name | N-[5-bromo-1-(2,2-dimethyl-6-nitrochromen-4-yl)-6-oxo-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22122949 |
| Molecular Formula | C18H16BrN3O5 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-[5-bromo-1-(2,2-dimethyl-6-nitrochromen-4-yl)-6-oxo-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Br)c(=O)n(C2=CC(C)(C)Oc3ccc([N+](=O)[O-])cc32)c1 |
| InChI | InChI=1S/C18H16BrN3O5/c1-10(23)20-11-6-14(19)17(24)21(9-11)15-8-18(2,3)27-16-5-4-12(22(25)26)7-13(15)16/h4-9H,1-3H3,(H,20,23) |
| InChIKey | ZIUUGJSXVYGFDA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|