C15H19N5O6 — CID 88500485
1-cyano-1-ethyl-2-(3,3,4-trihydroxy-2,2-dimethyl-6-nitrochromen-4-yl)guanidine (PubChem CID 88500485) has the molecular formula C15H19N5O6 and a molecular weight of 365.35 g/mol. Its IUPAC name is 1-cyano-1-ethyl-2-(3,3,4-trihydroxy-2,2-dimethyl-6-nitrochromen-4-yl)guanidine.
| Compound Name | 1-cyano-1-ethyl-2-(3,3,4-trihydroxy-2,2-dimethyl-6-nitrochromen-4-yl)guanidine |
|---|---|
| PubChem CID | 88500485 |
| Molecular Formula | C15H19N5O6 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-cyano-1-ethyl-2-(3,3,4-trihydroxy-2,2-dimethyl-6-nitrochromen-4-yl)guanidine |
| SMILES | CCN(C#N)/C(N)=N/C1(O)c2cc([N+](=O)[O-])ccc2OC(C)(C)C1(O)O |
| InChI | InChI=1S/C15H19N5O6/c1-4-19(8-16)12(17)18-14(21)10-7-9(20(24)25)5-6-11(10)26-13(2,3)15(14,22)23/h5-7,21-23H,4H2,1-3H3,(H2,17,18) |
| InChIKey | NMJMBTZXBVKTDT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 178.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|