C16H16ClNO — CID 19895591
2-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyridine (PubChem CID 19895591) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyridine.
| Compound Name | 2-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyridine |
|---|---|
| PubChem CID | 19895591 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyridine |
| SMILES | CC1(C)CC(c2ccccn2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C16H16ClNO/c1-16(2)10-13(14-5-3-4-8-18-14)12-9-11(17)6-7-15(12)19-16/h3-9,13H,10H2,1-2H3 |
| InChIKey | ACZYEOATKYAGCU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |