C6H12N4S — CID 19896364
N,N-dimethyl-2-(1-sulfanyltriazol-4-yl)ethanamine (PubChem CID 19896364) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-sulfanyltriazol-4-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(1-sulfanyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 19896364 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N,N-dimethyl-2-(1-sulfanyltriazol-4-yl)ethanamine |
| SMILES | CN(C)CCc1cn(S)nn1 |
| InChI | InChI=1S/C6H12N4S/c1-9(2)4-3-6-5-10(11)8-7-6/h5,11H,3-4H2,1-2H3 |
| InChIKey | TYHHMVVXMAWYBS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 33.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|