C23H32O6S — CID 19897191
methyl 7-[2-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate (PubChem CID 19897191) has the molecular formula C23H32O6S and a molecular weight of 436.57 g/mol. Its IUPAC name is methyl 7-[2-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[2-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 19897191 |
| Molecular Formula | C23H32O6S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 7-[2-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
| SMILES | COC(=O)CCCC#CC(O)C1C(=O)C(SC)=CC1(O)/C=C/C(O)C1CCCCC1 |
| InChI | InChI=1S/C23H32O6S/c1-29-20(26)12-8-4-7-11-18(25)21-22(27)19(30-2)15-23(21,28)14-13-17(24)16-9-5-3-6-10-16/h13-18,21,24-25,28H,3-6,8-10,12H2,1-2H3/b14-13+ |
| InChIKey | AFLVMIHZCKNNJD-BUHFOSPRSA-N |
| XLogP | 2.37 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|