C30H48O7SSi — CID 173362193
methyl 7-[5-(3-cyclopentyl-3-dimethylsilyloxy-4,4-dimethylpent-1-enyl)-3-(2,3-dihydroxypropylsulfanyl)-2-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate (PubChem CID 173362193) has the molecular formula C30H48O7SSi and a molecular weight of 580.86 g/mol. Its IUPAC name is methyl 7-[5-(3-cyclopentyl-3-dimethylsilyloxy-4,4-dimethylpent-1-enyl)-3-(2,3-dihydroxypropylsulfanyl)-2-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[5-(3-cyclopentyl-3-dimethylsilyloxy-4,4-dimethylpent-1-enyl)-3-(2,3-dihydroxypropylsulfanyl)-2-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 173362193 |
| Molecular Formula | C30H48O7SSi |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | methyl 7-[5-(3-cyclopentyl-3-dimethylsilyloxy-4,4-dimethylpent-1-enyl)-3-(2,3-dihydroxypropylsulfanyl)-2-oxocyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
| SMILES | COC(=O)CCCC#CC(O)C1C(=O)C(SCC(O)CO)=CC1C=CC(O[SiH](C)C)(C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C30H48O7SSi/c1-29(2,3)30(37-39(5)6,22-12-10-11-13-22)17-16-21-18-25(38-20-23(32)19-31)28(35)27(21)24(33)14-8-7-9-15-26(34)36-4/h16-18,21-24,27,31-33,39H,7,9-13,15,19-20H2,1-6H3 |
| InChIKey | DJYWUEJPLRIPSS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|