C15H14N2O7 — CID 19898272
ethyl 4-(2,4-dioxopiperidine-3-carbonyl)-3-nitrobenzoate (PubChem CID 19898272) has the molecular formula C15H14N2O7 and a molecular weight of 334.28 g/mol. Its IUPAC name is ethyl 4-(2,4-dioxopiperidine-3-carbonyl)-3-nitrobenzoate.
| Compound Name | ethyl 4-(2,4-dioxopiperidine-3-carbonyl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 19898272 |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | ethyl 4-(2,4-dioxopiperidine-3-carbonyl)-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)C2C(=O)CCNC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N2O7/c1-2-24-15(21)8-3-4-9(10(7-8)17(22)23)13(19)12-11(18)5-6-16-14(12)20/h3-4,7,12H,2,5-6H2,1H3,(H,16,20) |
| InChIKey | HBDLAFMVDDDIIA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|