C19H25NO — CID 19899700
2,3-dihydrofuran;4-(4-ethylcyclohexyl)benzonitrile (PubChem CID 19899700) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 2,3-dihydrofuran;4-(4-ethylcyclohexyl)benzonitrile.
| Compound Name | 2,3-dihydrofuran;4-(4-ethylcyclohexyl)benzonitrile |
|---|---|
| PubChem CID | 19899700 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2,3-dihydrofuran;4-(4-ethylcyclohexyl)benzonitrile |
| SMILES | C1=COCC1.CCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C15H19N.C4H6O/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15;1-2-4-5-3-1/h5-6,9-10,12,14H,2-4,7-8H2,1H3;1,3H,2,4H2 |
| InChIKey | IFEZKEBNKIXSEL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |