About 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile
5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile (PubChem CID 19907733) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile.
Analyze 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile (CID 19907733) is 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile is N#CC1=CC=CC(O)C1O.
What is the InChIKey of 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is NKIDLXZFLYJKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c8-4-5-2-1-3-6(9)7(5)10/h1-3,6-7,9-10H.
What are the key properties of 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile?
5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 137.14 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxycyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 19907733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).