C7H9NO2 — CID 102276937
(5S,6R)-5,6-dihydroxycyclohexene-1-carbonitrile (PubChem CID 102276937) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (5S,6R)-5,6-dihydroxycyclohexene-1-carbonitrile.
| Compound Name | (5S,6R)-5,6-dihydroxycyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 102276937 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (5S,6R)-5,6-dihydroxycyclohexene-1-carbonitrile |
| SMILES | N#CC1=CCC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H9NO2/c8-4-5-2-1-3-6(9)7(5)10/h2,6-7,9-10H,1,3H2/t6-,7+/m0/s1 |
| InChIKey | PHAOICKFUWHCDD-NKWVEPMBSA-N |
| XLogP | -0.05 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |