C19H17N3O2S — CID 19913688
N,N-dimethyl-10-oxo-11-phenyl-3-thia-8,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraene-13-carboxamide (PubChem CID 19913688) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is N,N-dimethyl-10-oxo-11-phenyl-3-thia-8,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraene-13-carboxamide.
| Compound Name | N,N-dimethyl-10-oxo-11-phenyl-3-thia-8,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraene-13-carboxamide |
|---|---|
| PubChem CID | 19913688 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N,N-dimethyl-10-oxo-11-phenyl-3-thia-8,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraene-13-carboxamide |
| SMILES | CN(C)C(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1CN2 |
| InChI | InChI=1S/C19H17N3O2S/c1-21(2)18(23)15-10-14(12-6-4-3-5-7-12)19(24)22-16(15)17-13(11-20-22)8-9-25-17/h3-10,20H,11H2,1-2H3 |
| InChIKey | ARNIELYKCHURLY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |