C24H21ClO3 — CID 19926495
3-[1-(4-chlorophenyl)-1-oxo-5-phenylpentan-3-yl]benzoic acid (PubChem CID 19926495) has the molecular formula C24H21ClO3 and a molecular weight of 392.88 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-1-oxo-5-phenylpentan-3-yl]benzoic acid.
| Compound Name | 3-[1-(4-chlorophenyl)-1-oxo-5-phenylpentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 19926495 |
| Molecular Formula | C24H21ClO3 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-1-oxo-5-phenylpentan-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(CCc2ccccc2)CC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H21ClO3/c25-22-13-11-18(12-14-22)23(26)16-20(10-9-17-5-2-1-3-6-17)19-7-4-8-21(15-19)24(27)28/h1-8,11-15,20H,9-10,16H2,(H,27,28) |
| InChIKey | CIPMCIBYCSUQAI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |