C16H12O4S — CID 19930245
7-hydroxy-3-(hydroxymethyl)-4-thiophen-3-ylnaphthalene-2-carboxylic acid (PubChem CID 19930245) has the molecular formula C16H12O4S and a molecular weight of 300.33 g/mol. Its IUPAC name is 7-hydroxy-3-(hydroxymethyl)-4-thiophen-3-ylnaphthalene-2-carboxylic acid.
| Compound Name | 7-hydroxy-3-(hydroxymethyl)-4-thiophen-3-ylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 19930245 |
| Molecular Formula | C16H12O4S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 7-hydroxy-3-(hydroxymethyl)-4-thiophen-3-ylnaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(O)ccc2c(-c2ccsc2)c1CO |
| InChI | InChI=1S/C16H12O4S/c17-7-14-13(16(19)20)6-10-5-11(18)1-2-12(10)15(14)9-3-4-21-8-9/h1-6,8,17-18H,7H2,(H,19,20) |
| InChIKey | XHERKVFNNCOWJZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |