C35H26F6O10 — CID 19931475
4-[4-[2-[4-(3,4-dicarboxyphenoxy)-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylphenoxy]phthalic acid (PubChem CID 19931475) has the molecular formula C35H26F6O10 and a molecular weight of 720.57 g/mol. Its IUPAC name is 4-[4-[2-[4-(3,4-dicarboxyphenoxy)-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylphenoxy]phthalic acid.
| Compound Name | 4-[4-[2-[4-(3,4-dicarboxyphenoxy)-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylphenoxy]phthalic acid |
|---|---|
| PubChem CID | 19931475 |
| Molecular Formula | C35H26F6O10 |
| Molecular Weight | 720.57 g/mol |
| Exact Mass | 720.14 |
| IUPAC Name | 4-[4-[2-[4-(3,4-dicarboxyphenoxy)-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,6-dimethylphenoxy]phthalic acid |
| SMILES | Cc1cc(C(c2cc(C)c(Oc3ccc(C(=O)O)c(C(=O)O)c3)c(C)c2)(C(F)(F)F)C(F)(F)F)cc(C)c1Oc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C35H26F6O10/c1-15-9-19(10-16(2)27(15)50-21-5-7-23(29(42)43)25(13-21)31(46)47)33(34(36,37)38,35(39,40)41)20-11-17(3)28(18(4)12-20)51-22-6-8-24(30(44)45)26(14-22)32(48)49/h5-14H,1-4H3,(H,42,43)(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | YJWQMVHBRWOSAB-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.57 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |