C19H13ClF3N3O7 — CID 19932404
2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]phenoxy]acetic acid (PubChem CID 19932404) has the molecular formula C19H13ClF3N3O7 and a molecular weight of 487.77 g/mol. Its IUPAC name is 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]phenoxy]acetic acid.
| Compound Name | 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 19932404 |
| Molecular Formula | C19H13ClF3N3O7 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]phenoxy]acetic acid |
| SMILES | Cn1nc(Oc2ccc([N+](=O)[O-])c(Oc3ccccc3OCC(=O)O)c2)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C19H13ClF3N3O7/c1-25-17(19(21,22)23)16(20)18(24-25)32-10-6-7-11(26(29)30)14(8-10)33-13-5-3-2-4-12(13)31-9-15(27)28/h2-8H,9H2,1H3,(H,27,28) |
| InChIKey | BEWWTQYBNFUHKW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|