C24H48N4 — CID 19937863
2,2,6,6-tetramethyl-N-[[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]methyl]piperidin-4-amine (PubChem CID 19937863) has the molecular formula C24H48N4 and a molecular weight of 392.68 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]methyl]piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-[[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 19937863 |
| Molecular Formula | C24H48N4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.39 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]methyl]piperidin-4-amine |
| SMILES | CC1(C)CC(NCC2CCN(C3CC(C)(C)NC(C)(C)C3)CC2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H48N4/c1-21(2)13-19(14-22(3,4)26-21)25-17-18-9-11-28(12-10-18)20-15-23(5,6)27-24(7,8)16-20/h18-20,25-27H,9-17H2,1-8H3 |
| InChIKey | TYDVGHDDQBECNP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |