C31H41N7O7 — CID 19952635
2-[[6-amino-2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 19952635) has the molecular formula C31H41N7O7 and a molecular weight of 623.71 g/mol. Its IUPAC name is 2-[[6-amino-2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 19952635 |
| Molecular Formula | C31H41N7O7 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 2-[[6-amino-2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H41N7O7/c32-14-4-3-7-24(29(42)38-26(31(44)45)16-19-17-35-23-6-2-1-5-21(19)23)37-30(43)25(12-13-27(34)40)36-28(41)22(33)15-18-8-10-20(39)11-9-18/h1-2,5-6,8-11,17,22,24-26,35,39H,3-4,7,12-16,32-33H2,(H2,34,40)(H,36,41)(H,37,43)(H,38,42)(H,44,45) |
| InChIKey | MJYZMWKQFDIXLJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|