C26H32N4O3 — CID 19955924
N-(diaminomethylidene)-2-(2-methylphenyl)-6-(3-pentoxypropoxy)quinoline-4-carboxamide (PubChem CID 19955924) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2-methylphenyl)-6-(3-pentoxypropoxy)quinoline-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-2-(2-methylphenyl)-6-(3-pentoxypropoxy)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19955924 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-(diaminomethylidene)-2-(2-methylphenyl)-6-(3-pentoxypropoxy)quinoline-4-carboxamide |
| SMILES | CCCCCOCCCOc1ccc2nc(-c3ccccc3C)cc(C(=O)N=C(N)N)c2c1 |
| InChI | InChI=1S/C26H32N4O3/c1-3-4-7-13-32-14-8-15-33-19-11-12-23-21(16-19)22(25(31)30-26(27)28)17-24(29-23)20-10-6-5-9-18(20)2/h5-6,9-12,16-17H,3-4,7-8,13-15H2,1-2H3,(H4,27,28,30,31) |
| InChIKey | VRCYALRSIQRGEX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|