C24H35NO3 — CID 19957686
4-ethoxy-2,3,5-trimethyl-6-[[2-(5-methyl-2-propan-2-ylphenoxy)ethylamino]methyl]phenol (PubChem CID 19957686) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-ethoxy-2,3,5-trimethyl-6-[[2-(5-methyl-2-propan-2-ylphenoxy)ethylamino]methyl]phenol.
| Compound Name | 4-ethoxy-2,3,5-trimethyl-6-[[2-(5-methyl-2-propan-2-ylphenoxy)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 19957686 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 4-ethoxy-2,3,5-trimethyl-6-[[2-(5-methyl-2-propan-2-ylphenoxy)ethylamino]methyl]phenol |
| SMILES | CCOc1c(C)c(C)c(O)c(CNCCOc2cc(C)ccc2C(C)C)c1C |
| InChI | InChI=1S/C24H35NO3/c1-8-27-24-18(6)17(5)23(26)21(19(24)7)14-25-11-12-28-22-13-16(4)9-10-20(22)15(2)3/h9-10,13,15,25-26H,8,11-12,14H2,1-7H3 |
| InChIKey | QELFDPYFXXPHKO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|