C6H8BrNO2 — CID 19958847
5-(bromomethyl)-3-(methoxymethyl)-1,2-oxazole (PubChem CID 19958847) has the molecular formula C6H8BrNO2 and a molecular weight of 206.04 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(methoxymethyl)-1,2-oxazole.
| Compound Name | 5-(bromomethyl)-3-(methoxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 19958847 |
| Molecular Formula | C6H8BrNO2 |
| Molecular Weight | 206.04 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | 5-(bromomethyl)-3-(methoxymethyl)-1,2-oxazole |
| SMILES | COCc1cc(CBr)on1 |
| InChI | InChI=1S/C6H8BrNO2/c1-9-4-5-2-6(3-7)10-8-5/h2H,3-4H2,1H3 |
| InChIKey | GZIKQCLIINSUEV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.04 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|