C6H10N2O3 — CID 79427575
O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine (PubChem CID 79427575) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine.
| Compound Name | O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 79427575 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine |
| SMILES | COCc1cc(CON)no1 |
| InChI | InChI=1S/C6H10N2O3/c1-9-4-6-2-5(3-10-7)8-11-6/h2H,3-4,7H2,1H3 |
| InChIKey | LGDIFJZYDJDRRE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|