About O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine
O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine (PubChem CID 79427575) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine |
| PubChem CID | 79427575 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine |
| SMILES | COCc1cc(CON)no1 |
| InChI | InChI=1S/C6H10N2O3/c1-9-4-6-2-5(3-10-7)8-11-6/h2H,3-4,7H2,1H3 |
| InChIKey | LGDIFJZYDJDRRE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine?
The IUPAC name of O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine (CID 79427575) is O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine.
What is the SMILES notation for O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine?
The canonical SMILES for O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine is COCc1cc(CON)no1.
What is the InChIKey of O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine?
The InChIKey is LGDIFJZYDJDRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-9-4-6-2-5(3-10-7)8-11-6/h2H,3-4,7H2,1H3.
What are the key properties of O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine?
O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine has a molecular weight of 158.16 g/mol, XLogP of 0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]hydroxylamine is sourced from PubChem (CID 79427575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).