C17H21N5O4 — CID 19959265
N-[2-(1-methylpiperidin-4-yl)ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 19959265) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-(1-methylpiperidin-4-yl)ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[2-(1-methylpiperidin-4-yl)ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 19959265 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[2-(1-methylpiperidin-4-yl)ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CN1CCC(CCNC(=O)c2noc(-c3ccc([N+](=O)[O-])cc3)n2)CC1 |
| InChI | InChI=1S/C17H21N5O4/c1-21-10-7-12(8-11-21)6-9-18-16(23)15-19-17(26-20-15)13-2-4-14(5-3-13)22(24)25/h2-5,12H,6-11H2,1H3,(H,18,23) |
| InChIKey | SCDQZPZHCOIJKL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|