C24H28N4O3 — CID 19959291
3-[4-(1-benzylpiperidin-4-yl)butyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19959291) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[4-(1-benzylpiperidin-4-yl)butyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(1-benzylpiperidin-4-yl)butyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19959291 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[4-(1-benzylpiperidin-4-yl)butyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(CCCCC3CCN(Cc4ccccc4)CC3)no2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c29-28(30)22-12-10-21(11-13-22)24-25-23(26-31-24)9-5-4-6-19-14-16-27(17-15-19)18-20-7-2-1-3-8-20/h1-3,7-8,10-13,19H,4-6,9,14-18H2 |
| InChIKey | DEMFZXRPRNBEPQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|