C27H30N4O6 — CID 67703873
N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-phenyl-1,2,4-oxadiazole-3-carboxamide;but-2-enedioic acid (PubChem CID 67703873) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-phenyl-1,2,4-oxadiazole-3-carboxamide;but-2-enedioic acid.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-phenyl-1,2,4-oxadiazole-3-carboxamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67703873 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-phenyl-1,2,4-oxadiazole-3-carboxamide;but-2-enedioic acid |
| SMILES | O=C(NCCC1CCN(Cc2ccccc2)CC1)c1noc(-c2ccccc2)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H26N4O2.C4H4O4/c28-22(21-25-23(29-26-21)20-9-5-2-6-10-20)24-14-11-18-12-15-27(16-13-18)17-19-7-3-1-4-8-19;5-3(6)1-2-4(7)8/h1-10,18H,11-17H2,(H,24,28);1-2H,(H,5,6)(H,7,8) |
| InChIKey | NMKNBSFGOFCQHJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|