C27H29N5O8 — CID 67703749
N-[2-(1-benzylpiperidin-4-yl)ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide;but-2-enedioic acid (PubChem CID 67703749) has the molecular formula C27H29N5O8 and a molecular weight of 551.56 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide;but-2-enedioic acid.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67703749 |
| Molecular Formula | C27H29N5O8 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide;but-2-enedioic acid |
| SMILES | O=C(NCCC1CCN(Cc2ccccc2)CC1)c1nc(-c2ccc([N+](=O)[O-])cc2)no1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H25N5O4.C4H4O4/c29-22(23-25-21(26-32-23)19-6-8-20(9-7-19)28(30)31)24-13-10-17-11-14-27(15-12-17)16-18-4-2-1-3-5-18;5-3(6)1-2-4(7)8/h1-9,17H,10-16H2,(H,24,29);1-2H,(H,5,6)(H,7,8) |
| InChIKey | SJWNIUUVRIRQSL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|