C24H27N5O5 — CID 19959136
N-[2-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 19959136) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[2-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[2-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 19959136 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[2-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | COc1cccc(CN2CCC(CCNC(=O)c3noc(-c4ccc([N+](=O)[O-])cc4)n3)CC2)c1 |
| InChI | InChI=1S/C24H27N5O5/c1-33-21-4-2-3-18(15-21)16-28-13-10-17(11-14-28)9-12-25-23(30)22-26-24(34-27-22)19-5-7-20(8-6-19)29(31)32/h2-8,15,17H,9-14,16H2,1H3,(H,25,30) |
| InChIKey | GTUBFURIUKBJCZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|