C21H20FNO4 — CID 19962401
ethyl (E)-3-[3-[(E)-3-amino-3-oxoprop-1-enyl]-5-[(3-fluorophenyl)-hydroxymethyl]phenyl]prop-2-enoate (PubChem CID 19962401) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl (E)-3-[3-[(E)-3-amino-3-oxoprop-1-enyl]-5-[(3-fluorophenyl)-hydroxymethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[(E)-3-amino-3-oxoprop-1-enyl]-5-[(3-fluorophenyl)-hydroxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19962401 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl (E)-3-[3-[(E)-3-amino-3-oxoprop-1-enyl]-5-[(3-fluorophenyl)-hydroxymethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(/C=C/C(N)=O)cc(C(O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H20FNO4/c1-2-27-20(25)9-7-15-10-14(6-8-19(23)24)11-17(12-15)21(26)16-4-3-5-18(22)13-16/h3-13,21,26H,2H2,1H3,(H2,23,24)/b8-6+,9-7+ |
| InChIKey | RYKILJLDOOIDDT-CDJQDVQCSA-N |
| XLogP | 2.98 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|