C20H21FN2O4 — CID 52527461
ethyl (E)-3-[4-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]prop-2-enoate (PubChem CID 52527461) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 52527461 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethyl (E)-3-[4-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)NC[C@H](O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H21FN2O4/c1-2-27-19(25)11-8-14-6-9-17(10-7-14)23-20(26)22-13-18(24)15-4-3-5-16(21)12-15/h3-12,18,24H,2,13H2,1H3,(H2,22,23,26)/b11-8+/t18-/m0/s1 |
| InChIKey | PYBKVIQWIPTISZ-MZEUMTGBSA-N |
| XLogP | 3.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|