C20H27ClN2O — CID 19963661
N-[2-[6-(4-chlorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]cyclopentanecarboxamide (PubChem CID 19963661) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is N-[2-[6-(4-chlorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[6-(4-chlorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 19963661 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[2-[6-(4-chlorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCN1CC2CC(c3ccc(Cl)cc3)C2C1)C1CCCC1 |
| InChI | InChI=1S/C20H27ClN2O/c21-17-7-5-14(6-8-17)18-11-16-12-23(13-19(16)18)10-9-22-20(24)15-3-1-2-4-15/h5-8,15-16,18-19H,1-4,9-13H2,(H,22,24) |
| InChIKey | RRSDGGKHDZOEBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |