C8H14N2O7S — CID 19976077
3-acetamido-6-amino-4-oxo-5-sulfohexanoic acid (PubChem CID 19976077) has the molecular formula C8H14N2O7S and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-acetamido-6-amino-4-oxo-5-sulfohexanoic acid.
| Compound Name | 3-acetamido-6-amino-4-oxo-5-sulfohexanoic acid |
|---|---|
| PubChem CID | 19976077 |
| Molecular Formula | C8H14N2O7S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-acetamido-6-amino-4-oxo-5-sulfohexanoic acid |
| SMILES | CC(=O)NC(CC(=O)O)C(=O)C(CN)S(=O)(=O)O |
| InChI | InChI=1S/C8H14N2O7S/c1-4(11)10-5(2-7(12)13)8(14)6(3-9)18(15,16)17/h5-6H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,15,16,17) |
| InChIKey | FJPSXTCVCQCZBT-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|