C7H7F6N3O3S2 — CID 19978584
trifluoromethanesulfonic acid;3-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol (PubChem CID 19978584) has the molecular formula C7H7F6N3O3S2 and a molecular weight of 359.27 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;3-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol.
| Compound Name | trifluoromethanesulfonic acid;3-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol |
|---|---|
| PubChem CID | 19978584 |
| Molecular Formula | C7H7F6N3O3S2 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | trifluoromethanesulfonic acid;3-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol |
| SMILES | FC(F)(F)c1nnc2n1CC(S)C2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H6F3N3S.CHF3O3S/c7-6(8,9)5-11-10-4-1-3(13)2-12(4)5;2-1(3,4)8(5,6)7/h3,13H,1-2H2;(H,5,6,7) |
| InChIKey | RRZGSYTVXSUGNL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|