C10H9FO2S — CID 19982162
8-fluoro-3,4-dihydro-2H-thiochromene-3-carboxylic acid (PubChem CID 19982162) has the molecular formula C10H9FO2S and a molecular weight of 212.24 g/mol. Its IUPAC name is 8-fluoro-3,4-dihydro-2H-thiochromene-3-carboxylic acid.
| Compound Name | 8-fluoro-3,4-dihydro-2H-thiochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 19982162 |
| Molecular Formula | C10H9FO2S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 8-fluoro-3,4-dihydro-2H-thiochromene-3-carboxylic acid |
| SMILES | O=C(O)C1CSc2c(F)cccc2C1 |
| InChI | InChI=1S/C10H9FO2S/c11-8-3-1-2-6-4-7(10(12)13)5-14-9(6)8/h1-3,7H,4-5H2,(H,12,13) |
| InChIKey | AIBABWDWAXDVAR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |