C7H9NO2 — CID 19982626
3-prop-2-enoxy-1,2-dihydropyrrol-5-one (PubChem CID 19982626) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-prop-2-enoxy-1,2-dihydropyrrol-5-one.
| Compound Name | 3-prop-2-enoxy-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 19982626 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-prop-2-enoxy-1,2-dihydropyrrol-5-one |
| SMILES | C=CCOC1=CC(=O)NC1 |
| InChI | InChI=1S/C7H9NO2/c1-2-3-10-6-4-7(9)8-5-6/h2,4H,1,3,5H2,(H,8,9) |
| InChIKey | ZYCMNJBSEMQXSF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|