C23H20FN — CID 19983749
4-[2-[4-(4-ethylphenyl)cyclohexen-1-yl]ethynyl]-2-fluorobenzonitrile (PubChem CID 19983749) has the molecular formula C23H20FN and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-[2-[4-(4-ethylphenyl)cyclohexen-1-yl]ethynyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-[4-(4-ethylphenyl)cyclohexen-1-yl]ethynyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 19983749 |
| Molecular Formula | C23H20FN |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-[2-[4-(4-ethylphenyl)cyclohexen-1-yl]ethynyl]-2-fluorobenzonitrile |
| SMILES | CCc1ccc(C2CC=C(C#Cc3ccc(C#N)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H20FN/c1-2-17-5-10-20(11-6-17)21-12-7-18(8-13-21)3-4-19-9-14-22(16-25)23(24)15-19/h5-7,9-11,14-15,21H,2,8,12-13H2,1H3 |
| InChIKey | YBUWYIMSTUMAJP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|