C19H27F5OS — CID 19993333
pentafluoro-[4-(4-pentoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane (PubChem CID 19993333) has the molecular formula C19H27F5OS and a molecular weight of 398.48 g/mol. Its IUPAC name is pentafluoro-[4-(4-pentoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-(4-pentoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 19993333 |
| Molecular Formula | C19H27F5OS |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | pentafluoro-[4-(4-pentoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane |
| SMILES | CCCCCOC12CCC(c3ccc(S(F)(F)(F)(F)F)cc3)(CC1)CC2 |
| InChI | InChI=1S/C19H27F5OS/c1-2-3-4-15-25-19-12-9-18(10-13-19,11-14-19)16-5-7-17(8-6-16)26(20,21,22,23)24/h5-8H,2-4,9-15H2,1H3 |
| InChIKey | PZTVVBPJAFCUGX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|