C18H25F5OS — CID 54037175
[4-(4-butoxy-1-bicyclo[2.2.2]octanyl)phenyl]-pentafluoro-λ6-sulfane (PubChem CID 54037175) has the molecular formula C18H25F5OS and a molecular weight of 384.45 g/mol. Its IUPAC name is [4-(4-butoxy-1-bicyclo[2.2.2]octanyl)phenyl]-pentafluoro-λ6-sulfane.
| Compound Name | [4-(4-butoxy-1-bicyclo[2.2.2]octanyl)phenyl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 54037175 |
| Molecular Formula | C18H25F5OS |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [4-(4-butoxy-1-bicyclo[2.2.2]octanyl)phenyl]-pentafluoro-λ6-sulfane |
| SMILES | CCCCOC12CCC(c3ccc(S(F)(F)(F)(F)F)cc3)(CC1)CC2 |
| InChI | InChI=1S/C18H25F5OS/c1-2-3-14-24-18-11-8-17(9-12-18,10-13-18)15-4-6-16(7-5-15)25(19,20,21,22)23/h4-7H,2-3,8-14H2,1H3 |
| InChIKey | LJUGDHIJXMIWHS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|