About 2-methylquinoline
2-methylquinoline (PubChem CID 7060) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-methylquinoline.
Molecular Properties
| Compound Name | 2-methylquinoline |
| PubChem CID | 7060 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 2-methylquinoline |
| SMILES | Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H9N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-7H,1H3 |
| InChIKey | SMUQFGGVLNAIOZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinoline?
The IUPAC name of 2-methylquinoline (CID 7060) is 2-methylquinoline.
What is the SMILES notation for 2-methylquinoline?
The canonical SMILES for 2-methylquinoline is Cc1ccc2ccccc2n1.
What is the InChIKey of 2-methylquinoline?
The InChIKey is SMUQFGGVLNAIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-7H,1H3.
What are the key properties of 2-methylquinoline?
2-methylquinoline has a molecular weight of 143.19 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinoline is sourced from PubChem (CID 7060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).